C25H27FN8O7 — CID 68851577
[1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]pyrazol-4-yl] N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 68851577) has the molecular formula C25H27FN8O7 and a molecular weight of 570.54 g/mol. Its IUPAC name is [1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]pyrazol-4-yl] N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | [1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]pyrazol-4-yl] N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 68851577 |
| Molecular Formula | C25H27FN8O7 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | [1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]pyrazol-4-yl] N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(F)cc1)Oc1cnn(-c2nc(N[C@@H]3CCOC3)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C25H27FN8O7/c26-14-3-1-13(2-4-14)7-27-25(38)40-16-8-29-34(9-16)24-31-21(30-15-5-6-39-11-15)18-22(32-24)33(12-28-18)23-20(37)19(36)17(10-35)41-23/h1-4,8-9,12,15,17,19-20,23,35-37H,5-7,10-11H2,(H,27,38)(H,30,31,32)/t15-,17-,19-,20-,23-/m1/s1 |
| InChIKey | LCYGPTMXTCDOFS-XDVJFCRTSA-N |
| XLogP | 0.25 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |