C27H30N8O8 — CID 69287493
methyl 4-[[[5-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]-1H-pyrazole-4-carbonyl]amino]methyl]benzoate (PubChem CID 69287493) has the molecular formula C27H30N8O8 and a molecular weight of 594.59 g/mol. Its IUPAC name is methyl 4-[[[5-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]-1H-pyrazole-4-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[5-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]-1H-pyrazole-4-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 69287493 |
| Molecular Formula | C27H30N8O8 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | methyl 4-[[[5-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-[[(3R)-oxolan-3-yl]amino]purin-2-yl]-1H-pyrazole-4-carbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cn[nH]c2-c2nc(N[C@@H]3CCOC3)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)cc1 |
| InChI | InChI=1S/C27H30N8O8/c1-41-27(40)14-4-2-13(3-5-14)8-28-25(39)16-9-30-34-18(16)22-32-23(31-15-6-7-42-11-15)19-24(33-22)35(12-29-19)26-21(38)20(37)17(10-36)43-26/h2-5,9,12,15,17,20-21,26,36-38H,6-8,10-11H2,1H3,(H,28,39)(H,30,34)(H,31,32,33)/t15-,17-,20-,21-,26-/m1/s1 |
| InChIKey | VIOMYURGPGJFAK-GULZFUJHSA-N |
| XLogP | -0.25 |
| TPSA | 218.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |