C14H16N8O5 — CID 142034865
5-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]-1H-pyrazole-4-carboxamide (PubChem CID 142034865) has the molecular formula C14H16N8O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is 5-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142034865 |
| Molecular Formula | C14H16N8O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn[nH]c1-c1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C14H16N8O5/c15-10-7-13(20-12(19-10)6-4(11(16)26)1-18-21-6)22(3-17-7)14-9(25)8(24)5(2-23)27-14/h1,3,5,8-9,14,23-25H,2H2,(H2,16,26)(H,18,21)(H2,15,19,20)/t5-,8-,9-,14-/m1/s1 |
| InChIKey | LNQBOWXNCZXFLB-KOEUUQBSSA-N |
| XLogP | -2.49 |
| TPSA | 211.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |