C24H27N9O5 — CID 87600048
N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]-2-(4-pyridin-4-yl-1H-pyrazol-5-yl)purin-9-yl]oxolan-2-yl]-N-ethylformamide (PubChem CID 87600048) has the molecular formula C24H27N9O5 and a molecular weight of 521.54 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]-2-(4-pyridin-4-yl-1H-pyrazol-5-yl)purin-9-yl]oxolan-2-yl]-N-ethylformamide.
| Compound Name | N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]-2-(4-pyridin-4-yl-1H-pyrazol-5-yl)purin-9-yl]oxolan-2-yl]-N-ethylformamide |
|---|---|
| PubChem CID | 87600048 |
| Molecular Formula | C24H27N9O5 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[6-[[(3R)-oxolan-3-yl]amino]-2-(4-pyridin-4-yl-1H-pyrazol-5-yl)purin-9-yl]oxolan-2-yl]-N-ethylformamide |
| SMILES | CCN(C=O)[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCOC4)nc(-c4[nH]ncc4-c4ccncc4)nc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H27N9O5/c1-2-32(12-34)23-18(35)19(36)24(38-23)33-11-26-17-21(28-14-5-8-37-10-14)29-20(30-22(17)33)16-15(9-27-31-16)13-3-6-25-7-4-13/h3-4,6-7,9,11-12,14,18-19,23-24,35-36H,2,5,8,10H2,1H3,(H,27,31)(H,28,29,30)/t14-,18-,19+,23+,24-/m1/s1 |
| InChIKey | OXLXYFSOIPJTCS-UTWXSXBMSA-N |
| XLogP | 0.53 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|