C22H24N6O5 — CID 87662483
N-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-[2-(4-methylphenyl)ethynyl]purin-9-yl]oxolan-2-yl]-N-ethylformamide (PubChem CID 87662483) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-[2-(4-methylphenyl)ethynyl]purin-9-yl]oxolan-2-yl]-N-ethylformamide.
| Compound Name | N-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-[2-(4-methylphenyl)ethynyl]purin-9-yl]oxolan-2-yl]-N-ethylformamide |
|---|---|
| PubChem CID | 87662483 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-[2-(4-methylphenyl)ethynyl]purin-9-yl]oxolan-2-yl]-N-ethylformamide |
| SMILES | CCN(C=O)[C@H]1O[C@@H](n2cnc3c(NOC)nc(C#Cc4ccc(C)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24N6O5/c1-4-27(12-29)21-17(30)18(31)22(33-21)28-11-23-16-19(26-32-3)24-15(25-20(16)28)10-9-14-7-5-13(2)6-8-14/h5-8,11-12,17-18,21-22,30-31H,4H2,1-3H3,(H,24,25,26)/t17-,18+,21-,22+/m0/s1 |
| InChIKey | XFDNRDHPJNIFIH-GKJHBJHPSA-N |
| XLogP | 0.56 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|