C20H19N7O6 — CID 10343891
(2S,3S,4R,5R)-5-[6-amino-2-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10343891) has the molecular formula C20H19N7O6 and a molecular weight of 453.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10343891 |
| Molecular Formula | C20H19N7O6 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(4-nitrophenyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#Cc4ccc([N+](=O)[O-])cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H19N7O6/c1-2-22-19(30)16-14(28)15(29)20(33-16)26-9-23-13-17(21)24-12(25-18(13)26)8-5-10-3-6-11(7-4-10)27(31)32/h3-4,6-7,9,14-16,20,28-29H,2H2,1H3,(H,22,30)(H2,21,24,25)/t14-,15+,16-,20+/m0/s1 |
| InChIKey | OZUCQMWPUTUNLW-KSVNGYGVSA-N |
| XLogP | -0.53 |
| TPSA | 191.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|