C19H20N6O5 — CID 91094823
8-[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methoxyamino)purin-2-yl]octa-5,7-diynenitrile (PubChem CID 91094823) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is 8-[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methoxyamino)purin-2-yl]octa-5,7-diynenitrile.
| Compound Name | 8-[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methoxyamino)purin-2-yl]octa-5,7-diynenitrile |
|---|---|
| PubChem CID | 91094823 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 8-[9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methoxyamino)purin-2-yl]octa-5,7-diynenitrile |
| SMILES | CONc1nc(C#CC#CCCCC#N)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C19H20N6O5/c1-29-24-17-14-18(23-13(22-17)8-6-4-2-3-5-7-9-20)25(11-21-14)19-16(28)15(27)12(10-26)30-19/h11-12,15-16,19,26-28H,3,5,7,10H2,1H3,(H,22,23,24) |
| InChIKey | YTBWIVYZZGQYOT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|