C22H22F3N5O5 — CID 87985059
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(propoxyamino)-2-[2-[2-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 87985059) has the molecular formula C22H22F3N5O5 and a molecular weight of 493.44 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(propoxyamino)-2-[2-[2-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(propoxyamino)-2-[2-[2-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 87985059 |
| Molecular Formula | C22H22F3N5O5 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(propoxyamino)-2-[2-[2-(trifluoromethyl)phenyl]ethynyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | CCCONc1nc(C#Cc2ccccc2C(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22F3N5O5/c1-2-9-34-29-19-16-20(30(11-26-16)21-18(33)17(32)14(10-31)35-21)28-15(27-19)8-7-12-5-3-4-6-13(12)22(23,24)25/h3-6,11,14,17-18,21,31-33H,2,9-10H2,1H3,(H,27,28,29)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | ZJPFWMRIBVABCX-HAXDFEGKSA-N |
| XLogP | 1.61 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|