C19H19N7O5 — CID 20810140
2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-(2-pyridin-2-ylethynyl)purin-9-yl]oxolan-2-yl]acetamide (PubChem CID 20810140) has the molecular formula C19H19N7O5 and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-(2-pyridin-2-ylethynyl)purin-9-yl]oxolan-2-yl]acetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-(2-pyridin-2-ylethynyl)purin-9-yl]oxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 20810140 |
| Molecular Formula | C19H19N7O5 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)-2-(2-pyridin-2-ylethynyl)purin-9-yl]oxolan-2-yl]acetamide |
| SMILES | CONc1nc(C#Cc2ccccn2)nc2c1ncn2[C@@H]1O[C@@H](CC(N)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19N7O5/c1-30-25-17-14-18(24-13(23-17)6-5-10-4-2-3-7-21-10)26(9-22-14)19-16(29)15(28)11(31-19)8-12(20)27/h2-4,7,9,11,15-16,19,28-29H,8H2,1H3,(H2,20,27)(H,23,24,25)/t11-,15+,16+,19+/m0/s1 |
| InChIKey | RGONALSMCDQODI-DKHNTLRKSA-N |
| XLogP | -0.91 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|