C23H28N6O8S — CID 87201702
4-[[6-(cyclopentylamino)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]methylcarbamoyl]benzenesulfonic acid (PubChem CID 87201702) has the molecular formula C23H28N6O8S and a molecular weight of 548.58 g/mol. Its IUPAC name is 4-[[6-(cyclopentylamino)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]methylcarbamoyl]benzenesulfonic acid.
| Compound Name | 4-[[6-(cyclopentylamino)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]methylcarbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87201702 |
| Molecular Formula | C23H28N6O8S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 4-[[6-(cyclopentylamino)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]methylcarbamoyl]benzenesulfonic acid |
| SMILES | O=C(NCc1nc(NC2CCCC2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)c2n1)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H28N6O8S/c30-10-15-18(31)19(32)23(37-15)29-11-25-17-20(26-13-3-1-2-4-13)27-16(28-21(17)29)9-24-22(33)12-5-7-14(8-6-12)38(34,35)36/h5-8,11,13,15,18-19,23,30-32H,1-4,9-10H2,(H,24,33)(H,26,27,28)(H,34,35,36)/t15-,18-,19+,23-/m1/s1 |
| InChIKey | MBEYBCOUHIPHTC-JYISGYRJSA-N |
| XLogP | -0.03 |
| TPSA | 209.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|