C18H19F3N6O5 — CID 168832111
N-[3-[9-[(3aR,4S,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurin-2-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 168832111) has the molecular formula C18H19F3N6O5 and a molecular weight of 456.38 g/mol. Its IUPAC name is N-[3-[9-[(3aR,4S,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurin-2-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[9-[(3aR,4S,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurin-2-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 168832111 |
| Molecular Formula | C18H19F3N6O5 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[3-[9-[(3aR,4S,6S,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurin-2-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](CO)O[C@@H]2n1cnc2c(N)nc(C#CCNC(=O)C(F)(F)F)nc21 |
| InChI | InChI=1S/C18H19F3N6O5/c1-17(2)31-11-8(6-28)30-15(12(11)32-17)27-7-24-10-13(22)25-9(26-14(10)27)4-3-5-23-16(29)18(19,20)21/h7-8,11-12,15,28H,5-6H2,1-2H3,(H,23,29)(H2,22,25,26)/t8-,11+,12+,15-/m0/s1 |
| InChIKey | ZAQMGBFMKVFZNI-DCDNZZDYSA-N |
| XLogP | -0.15 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|