C21H35N5O16P2 — CID 155096086
[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(6S)-1,2,3,4,6,7-hexahydroxy-5-methylheptyl] hydrogen phosphate (PubChem CID 155096086) has the molecular formula C21H35N5O16P2 and a molecular weight of 675.48 g/mol. Its IUPAC name is [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(6S)-1,2,3,4,6,7-hexahydroxy-5-methylheptyl] hydrogen phosphate.
| Compound Name | [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(6S)-1,2,3,4,6,7-hexahydroxy-5-methylheptyl] hydrogen phosphate |
|---|---|
| PubChem CID | 155096086 |
| Molecular Formula | C21H35N5O16P2 |
| Molecular Weight | 675.48 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | [[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] [(6S)-1,2,3,4,6,7-hexahydroxy-5-methylheptyl] hydrogen phosphate |
| SMILES | CC(C(O)C(O)C(O)C(O)OP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C2OC(C)(C)OC12)[C@H](O)CO |
| InChI | InChI=1S/C21H35N5O16P2/c1-8(9(28)4-27)12(29)13(30)14(31)20(32)41-44(35,36)42-43(33,34)37-5-10-15-16(40-21(2,3)39-15)19(38-10)26-7-25-11-17(22)23-6-24-18(11)26/h6-10,12-16,19-20,27-32H,4-5H2,1-3H3,(H,33,34)(H,35,36)(H2,22,23,24)/t8?,9-,10?,12?,13?,14?,15?,16?,19?,20?/m1/s1 |
| InChIKey | YQSQSOGPEHSBNU-YOUXLQOZSA-N |
| XLogP | -2.53 |
| TPSA | 320.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.48 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|