C24H37ClN5O9P — CID 126599461
ethyl (2R)-2-[[(3aR,4R,6R,6aR)-4-[2-chloro-6-(ethylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-diethoxyphosphorylpropanoate (PubChem CID 126599461) has the molecular formula C24H37ClN5O9P and a molecular weight of 606.01 g/mol. Its IUPAC name is ethyl (2R)-2-[[(3aR,4R,6R,6aR)-4-[2-chloro-6-(ethylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-diethoxyphosphorylpropanoate.
| Compound Name | ethyl (2R)-2-[[(3aR,4R,6R,6aR)-4-[2-chloro-6-(ethylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 126599461 |
| Molecular Formula | C24H37ClN5O9P |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | ethyl (2R)-2-[[(3aR,4R,6R,6aR)-4-[2-chloro-6-(ethylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-diethoxyphosphorylpropanoate |
| SMILES | CCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CO[C@@](C)(C(=O)OCC)P(=O)(OCC)OCC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C24H37ClN5O9P/c1-8-26-18-15-19(29-22(25)28-18)30(13-27-15)20-17-16(38-23(5,6)39-17)14(37-20)12-34-24(7,21(31)33-9-2)40(32,35-10-3)36-11-4/h13-14,16-17,20H,8-12H2,1-7H3,(H,26,28,29)/t14-,16-,17-,20-,24-/m1/s1 |
| InChIKey | NPZMCHKDNHSAFP-SVZQKWIASA-N |
| XLogP | 3.89 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|