C28H40ClN6O9P — CID 118478738
ethyl 2-[[(3aR,4R,6R,6aR)-4-(2-chloro-6-imidazol-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dibutoxyphosphorylacetate (PubChem CID 118478738) has the molecular formula C28H40ClN6O9P and a molecular weight of 671.09 g/mol. Its IUPAC name is ethyl 2-[[(3aR,4R,6R,6aR)-4-(2-chloro-6-imidazol-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dibutoxyphosphorylacetate.
| Compound Name | ethyl 2-[[(3aR,4R,6R,6aR)-4-(2-chloro-6-imidazol-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dibutoxyphosphorylacetate |
|---|---|
| PubChem CID | 118478738 |
| Molecular Formula | C28H40ClN6O9P |
| Molecular Weight | 671.09 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | ethyl 2-[[(3aR,4R,6R,6aR)-4-(2-chloro-6-imidazol-1-ylpurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-dibutoxyphosphorylacetate |
| SMILES | CCCCOP(=O)(OCCCC)C(OC[C@H]1O[C@@H](n2cnc3c(-n4ccnc4)nc(Cl)nc32)[C@@H]2OC(C)(C)O[C@@H]21)C(=O)OCC |
| InChI | InChI=1S/C28H40ClN6O9P/c1-6-9-13-40-45(37,41-14-10-7-2)26(25(36)38-8-3)39-15-18-20-21(44-28(4,5)43-20)24(42-18)35-17-31-19-22(34-12-11-30-16-34)32-27(29)33-23(19)35/h11-12,16-18,20-21,24,26H,6-10,13-15H2,1-5H3/t18-,20-,21-,24-,26?/m1/s1 |
| InChIKey | AYSLOQZCSWZDQV-WYORWXQISA-N |
| XLogP | 4.82 |
| TPSA | 160.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|