C17H25ClN5O9P — CID 118469692
2-[[(2R,3R,4R,5R)-5-[2-chloro-6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[ethoxy(hydroxy)phosphoryl]propanoic acid (PubChem CID 118469692) has the molecular formula C17H25ClN5O9P and a molecular weight of 509.84 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-5-[2-chloro-6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[ethoxy(hydroxy)phosphoryl]propanoic acid.
| Compound Name | 2-[[(2R,3R,4R,5R)-5-[2-chloro-6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[ethoxy(hydroxy)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 118469692 |
| Molecular Formula | C17H25ClN5O9P |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-5-[2-chloro-6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[ethoxy(hydroxy)phosphoryl]propanoic acid |
| SMILES | CCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(C)(C(=O)O)P(=O)(O)OCC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25ClN5O9P/c1-4-19-12-9-13(22-16(18)21-12)23(7-20-9)14-11(25)10(24)8(32-14)6-30-17(3,15(26)27)33(28,29)31-5-2/h7-8,10-11,14,24-25H,4-6H2,1-3H3,(H,26,27)(H,28,29)(H,19,21,22)/t8-,10+,11-,14-,17?/m1/s1 |
| InChIKey | CNDDCJTWXLAVCA-HSIRGMKVSA-N |
| XLogP | 0.57 |
| TPSA | 198.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|