C24H27N9O9 — CID 135466983
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-2-[(E)-[(4-methoxyphenyl)carbamoylamino]diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 135466983) has the molecular formula C24H27N9O9 and a molecular weight of 585.53 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-2-[(E)-[(4-methoxyphenyl)carbamoylamino]diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-2-[(E)-[(4-methoxyphenyl)carbamoylamino]diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135466983 |
| Molecular Formula | C24H27N9O9 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-amino-2-[(E)-[(4-methoxyphenyl)carbamoylamino]diazenyl]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | COc1ccc(NC(=O)N/N=N/c2nc(N)c3ncn([C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]4OC(C)=O)c3n2)cc1 |
| InChI | InChI=1S/C24H27N9O9/c1-11(34)39-9-16-18(40-12(2)35)19(41-13(3)36)22(42-16)33-10-26-17-20(25)28-23(29-21(17)33)30-32-31-24(37)27-14-5-7-15(38-4)8-6-14/h5-8,10,16,18-19,22H,9H2,1-4H3,(H4,25,27,28,29,30,31,37)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | UGWZONCVFOSSBD-WGQQHEPDSA-N |
| XLogP | 1.56 |
| TPSA | 232.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|