C18H21F3N6O6S — CID 46915762
[(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylsulfanylmethyl]oxolan-3-yl] acetate (PubChem CID 46915762) has the molecular formula C18H21F3N6O6S and a molecular weight of 506.46 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylsulfanylmethyl]oxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylsulfanylmethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 46915762 |
| Molecular Formula | C18H21F3N6O6S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylsulfanylmethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CSCCNC(=O)C(F)(F)F)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21F3N6O6S/c1-8(28)31-12-10(5-34-4-3-23-17(30)18(19,20)21)33-16(13(12)32-9(2)29)27-7-26-11-14(22)24-6-25-15(11)27/h6-7,10,12-13,16H,3-5H2,1-2H3,(H,23,30)(H2,22,24,25)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | UUEUQJOJKOCTPG-XNIJJKJLSA-N |
| XLogP | 0.58 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|