C19H24N4O7S — CID 45272313
2-[[(2S,3S,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methylsulfanyl]ethyl acetate (PubChem CID 45272313) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-[[(2S,3S,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methylsulfanyl]ethyl acetate.
| Compound Name | 2-[[(2S,3S,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methylsulfanyl]ethyl acetate |
|---|---|
| PubChem CID | 45272313 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-[[(2S,3S,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methylsulfanyl]ethyl acetate |
| SMILES | CC(=O)OCCSC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24N4O7S/c1-10(24)27-6-7-31-8-14-15(28-11(2)25)16(29-12(3)26)19(30-14)23-5-4-13-17(20)21-9-22-18(13)23/h4-5,9,14-16,19H,6-8H2,1-3H3,(H2,20,21,22)/t14-,15-,16-,19-/m1/s1 |
| InChIKey | WYLVDTFPAXNYMS-YKTARERQSA-N |
| XLogP | 1.07 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|