C18H27N5O5S — CID 512696
propan-2-yl 2-amino-4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate (PubChem CID 512696) has the molecular formula C18H27N5O5S and a molecular weight of 425.51 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate.
| Compound Name | propan-2-yl 2-amino-4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 512696 |
| Molecular Formula | C18H27N5O5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | propan-2-yl 2-amino-4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
| SMILES | CC(C)OC(=O)C(N)CCSC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27N5O5S/c1-9(2)27-18(26)11(19)4-6-29-7-12-13(24)14(25)17(28-12)23-5-3-10-15(20)21-8-22-16(10)23/h3,5,8-9,11-14,17,24-25H,4,6-7,19H2,1-2H3,(H2,20,21,22)/t11?,12-,13-,14-,17-/m1/s1 |
| InChIKey | CUISBYJUBBRLGB-OJUGKFCDSA-N |
| XLogP | 0.03 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|