C21H31N5O7S — CID 512692
propan-2-yl 4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2-methoxyacetyl)amino]butanoate (PubChem CID 512692) has the molecular formula C21H31N5O7S and a molecular weight of 497.57 g/mol. Its IUPAC name is propan-2-yl 4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2-methoxyacetyl)amino]butanoate.
| Compound Name | propan-2-yl 4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2-methoxyacetyl)amino]butanoate |
|---|---|
| PubChem CID | 512692 |
| Molecular Formula | C21H31N5O7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | propan-2-yl 4-[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2-methoxyacetyl)amino]butanoate |
| SMILES | COCC(=O)NC(CCSC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)OC(C)C |
| InChI | InChI=1S/C21H31N5O7S/c1-11(2)32-21(30)13(25-15(27)8-31-3)5-7-34-9-14-16(28)17(29)20(33-14)26-6-4-12-18(22)23-10-24-19(12)26/h4,6,10-11,13-14,16-17,20,28-29H,5,7-9H2,1-3H3,(H,25,27)(H2,22,23,24)/t13?,14-,16-,17-,20-/m1/s1 |
| InChIKey | QPAOBWJJFWNZRP-UEXBNONGSA-N |
| XLogP | -0.16 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|