C16H23N5O5S — CID 46876659
methyl 2-amino-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate (PubChem CID 46876659) has the molecular formula C16H23N5O5S and a molecular weight of 397.46 g/mol. Its IUPAC name is methyl 2-amino-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate.
| Compound Name | methyl 2-amino-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 46876659 |
| Molecular Formula | C16H23N5O5S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 2-amino-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
| SMILES | COC(=O)C(N)CCSC[C@H]1OC(n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23N5O5S/c1-25-16(24)9(17)3-5-27-6-10-11(22)12(23)15(26-10)21-4-2-8-13(18)19-7-20-14(8)21/h2,4,7,9-12,15,22-23H,3,5-6,17H2,1H3,(H2,18,19,20)/t9?,10-,11-,12-,15?/m1/s1 |
| InChIKey | YCOVPXDZYIFYBB-BRRYPZQOSA-N |
| XLogP | -0.74 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|