C20H26F3N5O6S — CID 22211234
propyl 4-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 22211234) has the molecular formula C20H26F3N5O6S and a molecular weight of 521.52 g/mol. Its IUPAC name is propyl 4-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | propyl 4-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 22211234 |
| Molecular Formula | C20H26F3N5O6S |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | propyl 4-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | CCCOC(=O)C(CCSCC1OC(n2ccc3c(N)ncnc32)C(O)C1O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H26F3N5O6S/c1-2-6-33-18(31)11(27-19(32)20(21,22)23)4-7-35-8-12-13(29)14(30)17(34-12)28-5-3-10-15(24)25-9-26-16(10)28/h3,5,9,11-14,17,29-30H,2,4,6-8H2,1H3,(H,27,32)(H2,24,25,26) |
| InChIKey | KPDUAIWKBQEJBL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|