C20H29N5O6S — CID 46876489
propyl 2-acetamido-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate (PubChem CID 46876489) has the molecular formula C20H29N5O6S and a molecular weight of 467.55 g/mol. Its IUPAC name is propyl 2-acetamido-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate.
| Compound Name | propyl 2-acetamido-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 46876489 |
| Molecular Formula | C20H29N5O6S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | propyl 2-acetamido-4-[[(2S,3S,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoate |
| SMILES | CCCOC(=O)C(CCSC[C@H]1OC(n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)NC(C)=O |
| InChI | InChI=1S/C20H29N5O6S/c1-3-7-30-20(29)13(24-11(2)26)5-8-32-9-14-15(27)16(28)19(31-14)25-6-4-12-17(21)22-10-23-18(12)25/h4,6,10,13-16,19,27-28H,3,5,7-9H2,1-2H3,(H,24,26)(H2,21,22,23)/t13?,14-,15-,16-,19?/m1/s1 |
| InChIKey | IQZUWHPFZWCSLO-HQWNSDKXSA-N |
| XLogP | 0.21 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|