C16H24N4O3 — CID 163819918
7-[(2R,3R,4R,5R)-3,4-diethoxy-5-ethyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 163819918) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-3,4-diethoxy-5-ethyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(2R,3R,4R,5R)-3,4-diethoxy-5-ethyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163819918 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-3,4-diethoxy-5-ethyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCO[C@@H]1[C@H](OCC)[C@@H](CC)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C16H24N4O3/c1-4-11-12(21-5-2)13(22-6-3)16(23-11)20-8-7-10-14(17)18-9-19-15(10)20/h7-9,11-13,16H,4-6H2,1-3H3,(H2,17,18,19)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | NUMQROGQTPOTJF-BRXULGCHSA-N |
| XLogP | 2.13 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |