C16H27N6O9P — CID 177107764
[(2R,4S,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 177107764) has the molecular formula C16H27N6O9P and a molecular weight of 478.40 g/mol. Its IUPAC name is [(2R,4S,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 177107764 |
| Molecular Formula | C16H27N6O9P |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | [(2R,4S,5R)-4-[2-(2-aminoethoxy)ethoxymethoxy]-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC1[C@@H](CO)O[C@@H](n2cnc3c(N)ncnc32)[C@H]1OCOCCOCCN |
| InChI | InChI=1S/C16H27N6O9P/c1-26-32(24,25)31-12-10(6-23)30-16(13(12)29-9-28-5-4-27-3-2-17)22-8-21-11-14(18)19-7-20-15(11)22/h7-8,10,12-13,16,23H,2-6,9,17H2,1H3,(H,24,25)(H2,18,19,20)/t10-,12?,13+,16-/m1/s1 |
| InChIKey | GIWBHSAERGPKLX-ZIWBQIBKSA-N |
| XLogP | -1.24 |
| TPSA | 208.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|