C19H18ClN5O8 — CID 18336824
[5-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]-1,2-oxazol-3-yl]methyl acetate (PubChem CID 18336824) has the molecular formula C19H18ClN5O8 and a molecular weight of 479.83 g/mol. Its IUPAC name is [5-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]-1,2-oxazol-3-yl]methyl acetate.
| Compound Name | [5-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]-1,2-oxazol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 18336824 |
| Molecular Formula | C19H18ClN5O8 |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [5-[(2S,3R,4R,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]-1,2-oxazol-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1cc([C@H]2O[C@@H](n3cnc4c(Cl)ncnc43)[C@H](OC(C)=O)[C@@H]2OC(C)=O)on1 |
| InChI | InChI=1S/C19H18ClN5O8/c1-8(26)29-5-11-4-12(33-24-11)14-15(30-9(2)27)16(31-10(3)28)19(32-14)25-7-23-13-17(20)21-6-22-18(13)25/h4,6-7,14-16,19H,5H2,1-3H3/t14-,15-,16-,19-/m1/s1 |
| InChIKey | UFJPBJVMOXZRHQ-YKTARERQSA-N |
| XLogP | 1.66 |
| TPSA | 157.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|