C13H17N4O4PS3 — CID 162202845
9-[(2R,3R,4S,5S)-3-hydroxy-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 162202845) has the molecular formula C13H17N4O4PS3 and a molecular weight of 420.48 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5S)-3-hydroxy-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5S)-3-hydroxy-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162202845 |
| Molecular Formula | C13H17N4O4PS3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 9-[(2R,3R,4S,5S)-3-hydroxy-4-methyl-5-[(2-sulfanylidene-1,3,2λ5-dithiaphospholan-2-yl)oxymethyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | C[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@H]1COP1(=S)SCCS1 |
| InChI | InChI=1S/C13H17N4O4PS3/c1-7-8(4-20-22(23)24-2-3-25-22)21-13(10(7)18)17-6-16-9-11(17)14-5-15-12(9)19/h5-8,10,13,18H,2-4H2,1H3,(H,14,15,19)/t7-,8-,10-,13-/m1/s1 |
| InChIKey | ZRURYHDYVZSUPO-ISDYYCSASA-N |
| XLogP | 1.74 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|