C19H39N2O8PSi3 — CID 90471522
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-trimethylsilyloxyoxolan-2-yl]methyl bis(trimethylsilyl) phosphate (PubChem CID 90471522) has the molecular formula C19H39N2O8PSi3 and a molecular weight of 538.76 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-trimethylsilyloxyoxolan-2-yl]methyl bis(trimethylsilyl) phosphate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-trimethylsilyloxyoxolan-2-yl]methyl bis(trimethylsilyl) phosphate |
|---|---|
| PubChem CID | 90471522 |
| Molecular Formula | C19H39N2O8PSi3 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-trimethylsilyloxyoxolan-2-yl]methyl bis(trimethylsilyl) phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H39N2O8PSi3/c1-14-12-21(19(23)20-18(14)22)17-11-15(27-31(2,3)4)16(26-17)13-25-30(24,28-32(5,6)7)29-33(8,9)10/h12,15-17H,11,13H2,1-10H3,(H,20,22,23)/t15-,16+,17+/m0/s1 |
| InChIKey | YJCOQJDRAMPSRW-GVDBMIGSSA-N |
| XLogP | 4.18 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|