C19H25N3O6 — CID 174061645
1-[(2R,5R)-4-[(4-aminophenyl)methoxymethoxy]-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174061645) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[(2R,5R)-4-[(4-aminophenyl)methoxymethoxy]-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-[(4-aminophenyl)methoxymethoxy]-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174061645 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[(2R,5R)-4-[(4-aminophenyl)methoxymethoxy]-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1OCOCc1ccc(N)cc1 |
| InChI | InChI=1S/C19H25N3O6/c1-12-8-22(19(24)21-18(12)23)17-7-15(16(28-17)10-25-2)27-11-26-9-13-3-5-14(20)6-4-13/h3-6,8,15-17H,7,9-11,20H2,1-2H3,(H,21,23,24)/t15?,16-,17-/m1/s1 |
| InChIKey | OFVYGWIVXZFSSO-YJEKIOLLSA-N |
| XLogP | 0.92 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|