C13H21N3O5 — CID 170393529
1-[(4R)-4-(aminomethoxy)-5-(2-methoxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 170393529) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-[(4R)-4-(aminomethoxy)-5-(2-methoxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4R)-4-(aminomethoxy)-5-(2-methoxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170393529 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[(4R)-4-(aminomethoxy)-5-(2-methoxyethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COCCC1OC(n2cc(C)c(=O)[nH]c2=O)C[C@H]1OCN |
| InChI | InChI=1S/C13H21N3O5/c1-8-6-16(13(18)15-12(8)17)11-5-10(20-7-14)9(21-11)3-4-19-2/h6,9-11H,3-5,7,14H2,1-2H3,(H,15,17,18)/t9?,10-,11?/m1/s1 |
| InChIKey | SWRWQPUQSJCKJU-HSOILSAZSA-N |
| XLogP | -0.53 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|