C23H26N8O6 — CID 21147480
[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 21147480) has the molecular formula C23H26N8O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 21147480 |
| Molecular Formula | C23H26N8O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C23H26N8O6/c1-12-10-31(22(34)28-20(12)32)19-8-16(29-30-24)18(37-19)11-36-23(35)27-17(21(33)25-2)7-13-9-26-15-6-4-3-5-14(13)15/h3-6,9-10,16-19,26H,7-8,11H2,1-2H3,(H,25,33)(H,27,35)(H,28,32,34)/t16?,17-,18?,19?/m0/s1 |
| InChIKey | CIPBHPGGLOGKLR-JRVPFXOQSA-N |
| XLogP | 1.38 |
| TPSA | 196.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|