C21H22N6O9 — CID 91458321
(2S)-2-[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyamino]-3-(2-oxalophenyl)propanoic acid (PubChem CID 91458321) has the molecular formula C21H22N6O9 and a molecular weight of 502.44 g/mol. Its IUPAC name is (2S)-2-[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyamino]-3-(2-oxalophenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyamino]-3-(2-oxalophenyl)propanoic acid |
|---|---|
| PubChem CID | 91458321 |
| Molecular Formula | C21H22N6O9 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (2S)-2-[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyamino]-3-(2-oxalophenyl)propanoic acid |
| SMILES | Cc1cn([C@H]2CC(N=[N+]=[N-])[C@@H](CON[C@@H](Cc3ccccc3C(=O)C(=O)O)C(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H22N6O9/c1-10-8-27(21(34)23-18(10)29)16-7-13(24-26-22)15(36-16)9-35-25-14(19(30)31)6-11-4-2-3-5-12(11)17(28)20(32)33/h2-5,8,13-16,25H,6-7,9H2,1H3,(H,30,31)(H,32,33)(H,23,29,34)/t13?,14-,15+,16+/m0/s1 |
| InChIKey | RATBCWWSCCNVPL-JAAVRUMLSA-N |
| XLogP | 0.30 |
| TPSA | 225.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|