C22H28N9O8P — CID 22892867
[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]-methylamino]amino]phosphonic acid (PubChem CID 22892867) has the molecular formula C22H28N9O8P and a molecular weight of 577.50 g/mol. Its IUPAC name is [[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]-methylamino]amino]phosphonic acid.
| Compound Name | [[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]-methylamino]amino]phosphonic acid |
|---|---|
| PubChem CID | 22892867 |
| Molecular Formula | C22H28N9O8P |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | [[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]-methylamino]amino]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](C(O)N(C)N(C(=O)[C@@H](N)Cc3c[nH]c4ccccc34)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28N9O8P/c1-11-10-30(22(35)26-19(11)32)17-8-16(27-28-24)18(39-17)21(34)29(2)31(40(36,37)38)20(33)14(23)7-12-9-25-15-6-4-3-5-13(12)15/h3-6,9-10,14,16-18,21,25,34H,7-8,23H2,1-2H3,(H,26,32,35)(H2,36,37,38)/t14-,16-,17+,18-,21?/m0/s1 |
| InChIKey | WYUUUJCCRVDXSG-DNKVXSDJSA-N |
| XLogP | -0.05 |
| TPSA | 255.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|