C27H30ClN10O11P — CID 10818768
bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-chlorophenyl)-hydroxymethyl] phosphate (PubChem CID 10818768) has the molecular formula C27H30ClN10O11P and a molecular weight of 737.02 g/mol. Its IUPAC name is bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-chlorophenyl)-hydroxymethyl] phosphate.
| Compound Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-chlorophenyl)-hydroxymethyl] phosphate |
|---|---|
| PubChem CID | 10818768 |
| Molecular Formula | C27H30ClN10O11P |
| Molecular Weight | 737.02 g/mol |
| Exact Mass | 736.15 |
| IUPAC Name | bis[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] [(4-chlorophenyl)-hydroxymethyl] phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(OC[C@H]3O[C@@H](n4cc(C)c(=O)[nH]c4=O)C[C@@H]3N=[N+]=[N-])OC(O)c3ccc(Cl)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H30ClN10O11P/c1-13-9-37(26(42)31-23(13)39)21-7-17(33-35-29)19(47-21)11-45-50(44,49-25(41)15-3-5-16(28)6-4-15)46-12-20-18(34-36-30)8-22(48-20)38-10-14(2)24(40)32-27(38)43/h3-6,9-10,17-22,25,41H,7-8,11-12H2,1-2H3,(H,31,39,42)(H,32,40,43)/t17-,18-,19+,20+,21+,22+,25?/m0/s1 |
| InChIKey | FXGMYIMPBNVVBD-LDEFKYNJSA-N |
| XLogP | 3.14 |
| TPSA | 290.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.02 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|