C18H30N6O7P — CID 59077427
CID 59077427 (PubChem CID 59077427) has the molecular formula C18H30N6O7P and a molecular weight of 473.45 g/mol.
| Compound Name | CID 59077427 |
|---|---|
| PubChem CID | 59077427 |
| Molecular Formula | C18H30N6O7P |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | — |
| SMILES | CCC(C)[CH]N(C)CCOP(=O)(O)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C18H30N6O7P/c1-5-12(2)9-23(4)6-7-29-32(27,28)30-11-15-14(21-22-19)8-16(31-15)24-10-13(3)17(25)20-18(24)26/h9-10,12,14-16H,5-8,11H2,1-4H3,(H,27,28)(H,20,25,26) |
| InChIKey | MQMYBYUIIAAJLD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|