C11H15F3N5O11P3 — CID 89318512
[[[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-fluorophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 89318512) has the molecular formula C11H15F3N5O11P3 and a molecular weight of 543.18 g/mol. Its IUPAC name is [[[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-fluorophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-fluorophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 89318512 |
| Molecular Formula | C11H15F3N5O11P3 |
| Molecular Weight | 543.18 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | [[[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-fluorophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@@H](N=[N+]=[N-])[C@@H](COP(=O)(F)OP(=O)(O)C(F)(F)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15F3N5O11P3/c1-5-3-19(10(21)16-9(5)20)8-2-6(17-18-15)7(29-8)4-28-33(14,27)30-32(25,26)11(12,13)31(22,23)24/h3,6-8H,2,4H2,1H3,(H,25,26)(H,16,20,21)(H2,22,23,24)/t6-,7-,8-,33?/m1/s1 |
| InChIKey | MRQVKBBYCYJWDU-NHISNZSXSA-N |
| XLogP | 1.84 |
| TPSA | 243.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|