C13H16Br3N2O11P3Se — CID 144630066
[dihydroxyphosphanyloxy(hydroxy)phosphanyl] [(2S,5R)-5-[2,4-dioxo-5-[3-(tribromomethylselanyl)prop-1-ynyl]pyrimidin-1-yl]oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 144630066) has the molecular formula C13H16Br3N2O11P3Se and a molecular weight of 787.87 g/mol. Its IUPAC name is [dihydroxyphosphanyloxy(hydroxy)phosphanyl] [(2S,5R)-5-[2,4-dioxo-5-[3-(tribromomethylselanyl)prop-1-ynyl]pyrimidin-1-yl]oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [dihydroxyphosphanyloxy(hydroxy)phosphanyl] [(2S,5R)-5-[2,4-dioxo-5-[3-(tribromomethylselanyl)prop-1-ynyl]pyrimidin-1-yl]oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 144630066 |
| Molecular Formula | C13H16Br3N2O11P3Se |
| Molecular Weight | 787.87 g/mol |
| Exact Mass | 785.67 |
| IUPAC Name | [dihydroxyphosphanyloxy(hydroxy)phosphanyl] [(2S,5R)-5-[2,4-dioxo-5-[3-(tribromomethylselanyl)prop-1-ynyl]pyrimidin-1-yl]oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC[C@@H](COP(=O)(O)OP(O)OP(O)O)O2)cc1C#CC[Se]C(Br)(Br)Br |
| InChI | InChI=1S/C13H16Br3N2O11P3Se/c14-13(15,16)33-5-1-2-8-6-18(12(20)17-11(8)19)10-4-3-9(27-10)7-26-32(24,25)29-31(23)28-30(21)22/h6,9-10,21-23H,3-5,7H2,(H,24,25)(H,17,19,20)/t9-,10+,31?/m0/s1 |
| InChIKey | ZXXXSAWRLUZHQX-BKAWDFFESA-N |
| XLogP | 2.07 |
| TPSA | 189.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|