C22H34N6O5 — CID 118402740
5-[6-[3-[3-(2-aminoethoxy)propyl]-1,2-dihydrotriazol-5-yl]hex-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 118402740) has the molecular formula C22H34N6O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 5-[6-[3-[3-(2-aminoethoxy)propyl]-1,2-dihydrotriazol-5-yl]hex-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[6-[3-[3-(2-aminoethoxy)propyl]-1,2-dihydrotriazol-5-yl]hex-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118402740 |
| Molecular Formula | C22H34N6O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-[6-[3-[3-(2-aminoethoxy)propyl]-1,2-dihydrotriazol-5-yl]hex-1-ynyl]-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | NCCOCCCN1C=C(CCCCC#Cc2cn([C@H]3CC[C@@H](CO)O3)c(=O)[nH]c2=O)NN1 |
| InChI | InChI=1S/C22H34N6O5/c23-10-13-32-12-5-11-27-15-18(25-26-27)7-4-2-1-3-6-17-14-28(22(31)24-21(17)30)20-9-8-19(16-29)33-20/h14-15,19-20,25-26,29H,1-2,4-5,7-13,16,23H2,(H,24,30,31)/t19-,20+/m0/s1 |
| InChIKey | APJFNTBRINVHKO-VQTJNVASSA-N |
| XLogP | -0.35 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|