C30H48N6O7 — CID 90883758
5-[6-[1-[4-(4-amino-2-methylbutan-2-yl)oxy-2,2-dimethylbutyl]triazol-4-yl]hex-1-ynyl]-1-[5-(hydroxymethyl)-4-(methoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90883758) has the molecular formula C30H48N6O7 and a molecular weight of 604.75 g/mol. Its IUPAC name is 5-[6-[1-[4-(4-amino-2-methylbutan-2-yl)oxy-2,2-dimethylbutyl]triazol-4-yl]hex-1-ynyl]-1-[5-(hydroxymethyl)-4-(methoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[6-[1-[4-(4-amino-2-methylbutan-2-yl)oxy-2,2-dimethylbutyl]triazol-4-yl]hex-1-ynyl]-1-[5-(hydroxymethyl)-4-(methoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90883758 |
| Molecular Formula | C30H48N6O7 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 5-[6-[1-[4-(4-amino-2-methylbutan-2-yl)oxy-2,2-dimethylbutyl]triazol-4-yl]hex-1-ynyl]-1-[5-(hydroxymethyl)-4-(methoxymethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COCOC1CC(n2cc(C#CCCCCc3cn(CC(C)(C)CCOC(C)(C)CCN)nn3)c(=O)[nH]c2=O)OC1CO |
| InChI | InChI=1S/C30H48N6O7/c1-29(2,13-15-42-30(3,4)12-14-31)20-35-18-23(33-34-35)11-9-7-6-8-10-22-17-36(28(39)32-27(22)38)26-16-24(41-21-40-5)25(19-37)43-26/h17-18,24-26,37H,6-7,9,11-16,19-21,31H2,1-5H3,(H,32,38,39) |
| InChIKey | SIHDZJOMLZRLNZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 168.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|