C30H48N3O9P — CID 130346696
2-cyanoethyl [(2R,3R,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-(3,4,5-trimethyl-2-propan-2-ylheptan-3-yl)oxyethyl phosphate (PubChem CID 130346696) has the molecular formula C30H48N3O9P and a molecular weight of 625.70 g/mol. Its IUPAC name is 2-cyanoethyl [(2R,3R,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-(3,4,5-trimethyl-2-propan-2-ylheptan-3-yl)oxyethyl phosphate.
| Compound Name | 2-cyanoethyl [(2R,3R,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-(3,4,5-trimethyl-2-propan-2-ylheptan-3-yl)oxyethyl phosphate |
|---|---|
| PubChem CID | 130346696 |
| Molecular Formula | C30H48N3O9P |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | 2-cyanoethyl [(2R,3R,5R)-5-(2,4-dioxo-5-prop-1-ynylpyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-(3,4,5-trimethyl-2-propan-2-ylheptan-3-yl)oxyethyl phosphate |
| SMILES | CC#Cc1cn([C@H]2C[C@@H](OP(=O)(OCCC#N)OCCOC(C)(C(C)C(C)C)C(C)C(C)CC)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H48N3O9P/c1-9-12-24-18-33(29(36)32-28(24)35)27-17-25(26(19-34)41-27)42-43(37,39-14-11-13-31)40-16-15-38-30(8,22(6)20(3)4)23(7)21(5)10-2/h18,20-23,25-27,34H,10-11,14-17,19H2,1-8H3,(H,32,35,36)/t21?,22?,23?,25-,26-,27-,30?,43?/m1/s1 |
| InChIKey | UVITYTCBLWTSFQ-UGRZLUTQSA-N |
| XLogP | 4.38 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|