C23H33N4O11P — CID 11060856
[(2R,3S,5R)-3-[(2,2-dicyano-3-hydroxypropoxy)-(2-methoxyethoxy)phosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11060856) has the molecular formula C23H33N4O11P and a molecular weight of 572.51 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[(2,2-dicyano-3-hydroxypropoxy)-(2-methoxyethoxy)phosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R)-3-[(2,2-dicyano-3-hydroxypropoxy)-(2-methoxyethoxy)phosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11060856 |
| Molecular Formula | C23H33N4O11P |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | [(2R,3S,5R)-3-[(2,2-dicyano-3-hydroxypropoxy)-(2-methoxyethoxy)phosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COCCOP(=O)(OCC(C#N)(C#N)CO)O[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H33N4O11P/c1-15-9-27(21(31)26-19(15)29)18-8-16(17(37-18)10-34-20(30)22(2,3)4)38-39(32,35-7-6-33-5)36-14-23(11-24,12-25)13-28/h9,16-18,28H,6-8,10,13-14H2,1-5H3,(H,26,29,31)/t16-,17+,18+,39?/m0/s1 |
| InChIKey | DHJZVSNMAAZXAZ-LABUEVLPSA-N |
| XLogP | 0.92 |
| TPSA | 212.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|