C14H19N5O4 — CID 134331113
N'-[3-[1-[6-(hydroxymethyl)morpholin-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]ethanimidamide (PubChem CID 134331113) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is N'-[3-[1-[6-(hydroxymethyl)morpholin-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]ethanimidamide.
| Compound Name | N'-[3-[1-[6-(hydroxymethyl)morpholin-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]ethanimidamide |
|---|---|
| PubChem CID | 134331113 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N'-[3-[1-[6-(hydroxymethyl)morpholin-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]ethanimidamide |
| SMILES | C/C(N)=N\CC#Cc1cn(C2CNCC(CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H19N5O4/c1-9(15)17-4-2-3-10-7-19(14(22)18-13(10)21)12-6-16-5-11(8-20)23-12/h7,11-12,16,20H,4-6,8H2,1H3,(H2,15,17)(H,18,21,22) |
| InChIKey | MOCWLZMEFRYBIH-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|