C15H21N8O3P3 — CID 58021805
5-(3-aminoprop-1-ynyl)-7-[4-(azidomethoxy)-5-[bis(phosphanyl)phosphanyloxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 58021805) has the molecular formula C15H21N8O3P3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-7-[4-(azidomethoxy)-5-[bis(phosphanyl)phosphanyloxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(3-aminoprop-1-ynyl)-7-[4-(azidomethoxy)-5-[bis(phosphanyl)phosphanyloxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58021805 |
| Molecular Formula | C15H21N8O3P3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-7-[4-(azidomethoxy)-5-[bis(phosphanyl)phosphanyloxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | [N-]=[N+]=NCOC1CC(n2cc(C#CCN)c3c(N)ncnc32)OC1COP(P)P |
| InChI | InChI=1S/C15H21N8O3P3/c16-3-1-2-9-5-23(15-13(9)14(17)19-7-20-15)12-4-10(24-8-21-22-18)11(26-12)6-25-29(27)28/h5,7,10-12H,3-4,6,8,16,27-28H2,(H2,17,19,20) |
| InChIKey | LFDHHSLZJQUMGZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|