C14H18N4O4 — CID 89244680
2-[5-ethenyl-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolan-3-ol (PubChem CID 89244680) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[5-ethenyl-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolan-3-ol.
| Compound Name | 2-[5-ethenyl-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolan-3-ol |
|---|---|
| PubChem CID | 89244680 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[5-ethenyl-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolan-3-ol |
| SMILES | C=Cc1cn(C2OC(CO)CC2(C)O)c2ncnc(NO)c12 |
| InChI | InChI=1S/C14H18N4O4/c1-3-8-5-18(12-10(8)11(17-21)15-7-16-12)13-14(2,20)4-9(6-19)22-13/h3,5,7,9,13,19-21H,1,4,6H2,2H3,(H,15,16,17) |
| InChIKey | OJBFEHIWEUDSNU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|