C11H16N4O13P2S — CID 175677559
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl sulfo hydrogen phosphate (PubChem CID 175677559) has the molecular formula C11H16N4O13P2S and a molecular weight of 506.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl sulfo hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl sulfo hydrogen phosphate |
|---|---|
| PubChem CID | 175677559 |
| Molecular Formula | C11H16N4O13P2S |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methyl sulfo hydrogen phosphate |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](COP(=O)(O)OS(=O)(=O)O)[C@@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C11H16N4O13P2S/c12-9-5-1-2-15(10(5)14-4-13-9)11-7(16)8(27-29(17,18)19)6(26-11)3-25-30(20,21)28-31(22,23)24/h1-2,4,6-8,11,16H,3H2,(H,20,21)(H2,12,13,14)(H2,17,18,19)(H,22,23,24)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | MQJSJYQLDFYHTA-KCGFPETGSA-N |
| XLogP | -1.31 |
| TPSA | 263.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|