C10H15N8O13P3 — CID 139423499
[[4-(6-amino-8-azidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 139423499) has the molecular formula C10H15N8O13P3 and a molecular weight of 548.20 g/mol. Its IUPAC name is [[4-(6-amino-8-azidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[4-(6-amino-8-azidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139423499 |
| Molecular Formula | C10H15N8O13P3 |
| Molecular Weight | 548.20 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | [[4-(6-amino-8-azidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=Nc1nc2c(N)ncnc2n1C1(O)COC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1O |
| InChI | InChI=1S/C10H15N8O13P3/c11-7-5-8(14-3-13-7)18(9(15-5)16-17-12)10(20)2-28-4(6(10)19)1-29-33(24,25)31-34(26,27)30-32(21,22)23/h3-4,6,19-20H,1-2H2,(H,24,25)(H,26,27)(H2,11,13,14)(H2,21,22,23) |
| InChIKey | BMLUHRQNCNJZCX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 327.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|