C21H28N5O13P3S2 — CID 170937002
[(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate (PubChem CID 170937002) has the molecular formula C21H28N5O13P3S2 and a molecular weight of 715.53 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate.
| Compound Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate |
|---|---|
| PubChem CID | 170937002 |
| Molecular Formula | C21H28N5O13P3S2 |
| Molecular Weight | 715.53 g/mol |
| Exact Mass | 715.03 |
| IUPAC Name | [(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate |
| SMILES | CCSSC(C)c1ccccc1C(=O)O[C@@H]1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C21H28N5O13P3S2/c1-3-43-44-12(2)13-6-4-5-7-14(13)21(27)37-15-8-17(26-11-25-18-19(22)23-10-24-20(18)26)36-16(15)9-35-41(31,32)39-42(33,34)38-40(28,29)30/h4-7,10-12,15-17H,3,8-9H2,1-2H3,(H,31,32)(H,33,34)(H2,22,23,24)(H2,28,29,30)/t12?,15-,16-,17-/m1/s1 |
| InChIKey | VAFOZWORMBLPGC-PUPMKRJOSA-N |
| XLogP | 3.73 |
| TPSA | 264.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|