C27H39N5O4S2Si — CID 174116702
[(2R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate (PubChem CID 174116702) has the molecular formula C27H39N5O4S2Si and a molecular weight of 589.86 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate |
|---|---|
| PubChem CID | 174116702 |
| Molecular Formula | C27H39N5O4S2Si |
| Molecular Weight | 589.86 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl] 2-[1-(ethyldisulfanyl)ethyl]benzoate |
| SMILES | CCSSC(C)c1ccccc1C(=O)OC1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H39N5O4S2Si/c1-8-37-38-17(2)18-11-9-10-12-19(18)26(33)36-20-13-22(32-16-31-23-24(28)29-15-30-25(23)32)35-21(20)14-34-39(6,7)27(3,4)5/h9-12,15-17,20-22H,8,13-14H2,1-7H3,(H2,28,29,30)/t17?,20?,21-,22-/m1/s1 |
| InChIKey | YDTGBHJESAGYLG-MNAWUITFSA-N |
| XLogP | 6.41 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.86 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|