C16H26N6O16P4-4 — CID 140603354
[6-aminohexoxy(oxido)phosphoryl] [[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 140603354) has the molecular formula C16H26N6O16P4-4 and a molecular weight of 682.31 g/mol. Its IUPAC name is [6-aminohexoxy(oxido)phosphoryl] [[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [6-aminohexoxy(oxido)phosphoryl] [[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 140603354 |
| Molecular Formula | C16H26N6O16P4-4 |
| Molecular Weight | 682.31 g/mol |
| Exact Mass | 682.04 |
| IUPAC Name | [6-aminohexoxy(oxido)phosphoryl] [[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | NCCCCCCOP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)CC1O |
| InChI | InChI=1S/C16H30N6O16P4/c17-5-3-1-2-4-6-33-39(25,26)36-41(29,30)38-42(31,32)37-40(27,28)34-8-11-10(23)7-12(35-11)22-9-19-13-14(22)20-16(18)21-15(13)24/h9-12,23H,1-8,17H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H3,18,20,21,24)/p-4/t10?,11-,12-/m1/s1 |
| InChIKey | VKQSXLQOUWBVQP-PQDIPPBSSA-J |
| XLogP | -2.17 |
| TPSA | 351.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.31 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|