C10H12FN4O6PS — CID 137123205
9-[(2R,3S,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluoro-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 137123205) has the molecular formula C10H12FN4O6PS and a molecular weight of 366.27 g/mol. Its IUPAC name is 9-[(2R,3S,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluoro-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluoro-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137123205 |
| Molecular Formula | C10H12FN4O6PS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 9-[(2R,3S,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-3-fluoro-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](COP(O)(O)=S)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C10H12FN4O6PS/c11-5-7(16)4(1-20-22(18,19)23)21-10(5)15-3-14-6-8(15)12-2-13-9(6)17/h2-5,7,10,16H,1H2,(H,12,13,17)(H2,18,19,23)/t4-,5+,7-,10-/m1/s1 |
| InChIKey | FNFCRBAPUWMSDU-GQTRHBFLSA-N |
| XLogP | -1.06 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|